C9H6N2O2S — CID 170474874
methyl 2-(3-cyanoprop-1-ynyl)-1,3-thiazole-5-carboxylate (PubChem CID 170474874) has the molecular formula C9H6N2O2S and a molecular weight of 206.23 g/mol. Its IUPAC name is methyl 2-(3-cyanoprop-1-ynyl)-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 2-(3-cyanoprop-1-ynyl)-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 170474874 |
| Molecular Formula | C9H6N2O2S |
| Molecular Weight | 206.23 g/mol |
| Exact Mass | 206.01 |
| IUPAC Name | methyl 2-(3-cyanoprop-1-ynyl)-1,3-thiazole-5-carboxylate |
| SMILES | COC(=O)c1cnc(C#CCC#N)s1 |
| InChI | InChI=1S/C9H6N2O2S/c1-13-9(12)7-6-11-8(14-7)4-2-3-5-10/h6H,3H2,1H3 |
| InChIKey | UUVCEXZHGUFLHU-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.23 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|