About [(5-nitro-1,3-thiazol-2-yl)methylideneamino]thiourea
[(5-nitro-1,3-thiazol-2-yl)methylideneamino]thiourea (PubChem CID 3008054) has the molecular formula C5H5N5O2S2
and a molecular weight of 231.26 g/mol. Its IUPAC name is [(5-nitro-1,3-thiazol-2-yl)methylideneamino]thiourea.
Molecular Properties
| Compound Name | [(5-nitro-1,3-thiazol-2-yl)methylideneamino]thiourea |
| PubChem CID | 3008054 |
| Molecular Formula | C5H5N5O2S2 |
| Molecular Weight | 231.26 g/mol |
| Exact Mass | 230.99 |
| IUPAC Name | [(5-nitro-1,3-thiazol-2-yl)methylideneamino]thiourea |
| SMILES | NC(=S)NN=Cc1ncc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C5H5N5O2S2/c6-5(13)9-8-1-3-7-2-4(14-3)10(11)12/h1-2H,(H3,6,9,13) |
| InChIKey | YKABOPJLOUYIPU-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 106.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.26 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [(5-nitro-1,3-thiazol-2-yl)methylideneamino]thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(5-nitro-1,3-thiazol-2-yl)methylideneamino]thiourea?
The IUPAC name of [(5-nitro-1,3-thiazol-2-yl)methylideneamino]thiourea (CID 3008054) is [(5-nitro-1,3-thiazol-2-yl)methylideneamino]thiourea.
What is the SMILES notation for [(5-nitro-1,3-thiazol-2-yl)methylideneamino]thiourea?
The canonical SMILES for [(5-nitro-1,3-thiazol-2-yl)methylideneamino]thiourea is NC(=S)NN=Cc1ncc([N+](=O)[O-])s1.
What is the InChIKey of [(5-nitro-1,3-thiazol-2-yl)methylideneamino]thiourea?
The InChIKey is YKABOPJLOUYIPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5N5O2S2/c6-5(13)9-8-1-3-7-2-4(14-3)10(11)12/h1-2H,(H3,6,9,13).
What are the key properties of [(5-nitro-1,3-thiazol-2-yl)methylideneamino]thiourea?
[(5-nitro-1,3-thiazol-2-yl)methylideneamino]thiourea has a molecular weight of 231.26 g/mol, XLogP of 0.22, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(5-nitro-1,3-thiazol-2-yl)methylideneamino]thiourea is sourced from PubChem (CID 3008054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).