C5H5N5O2S2 — CID 3008054
[(5-nitro-1,3-thiazol-2-yl)methylideneamino]thiourea (PubChem CID 3008054) has the molecular formula C5H5N5O2S2 and a molecular weight of 231.26 g/mol. Its IUPAC name is [(5-nitro-1,3-thiazol-2-yl)methylideneamino]thiourea.
| Compound Name | [(5-nitro-1,3-thiazol-2-yl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 3008054 |
| Molecular Formula | C5H5N5O2S2 |
| Molecular Weight | 231.26 g/mol |
| Exact Mass | 230.99 |
| IUPAC Name | [(5-nitro-1,3-thiazol-2-yl)methylideneamino]thiourea |
| SMILES | NC(=S)NN=Cc1ncc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C5H5N5O2S2/c6-5(13)9-8-1-3-7-2-4(14-3)10(11)12/h1-2H,(H3,6,9,13) |
| InChIKey | YKABOPJLOUYIPU-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 106.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.26 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|