C9H12N6O4S — CID 21390859
2-[2-[(E)-(carbamothioylhydrazinylidene)methyl]-5-nitroimidazol-1-yl]ethyl acetate (PubChem CID 21390859) has the molecular formula C9H12N6O4S and a molecular weight of 300.30 g/mol. Its IUPAC name is 2-[2-[(E)-(carbamothioylhydrazinylidene)methyl]-5-nitroimidazol-1-yl]ethyl acetate.
| Compound Name | 2-[2-[(E)-(carbamothioylhydrazinylidene)methyl]-5-nitroimidazol-1-yl]ethyl acetate |
|---|---|
| PubChem CID | 21390859 |
| Molecular Formula | C9H12N6O4S |
| Molecular Weight | 300.30 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | 2-[2-[(E)-(carbamothioylhydrazinylidene)methyl]-5-nitroimidazol-1-yl]ethyl acetate |
| SMILES | CC(=O)OCCn1c([N+](=O)[O-])cnc1/C=N/NC(N)=S |
| InChI | InChI=1S/C9H12N6O4S/c1-6(16)19-3-2-14-7(4-12-13-9(10)20)11-5-8(14)15(17)18/h4-5H,2-3H2,1H3,(H3,10,13,20)/b12-4+ |
| InChIKey | PVMUJJKBWLAVHG-UUILKARUSA-N |
| XLogP | -0.48 |
| TPSA | 137.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.30 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|