C7H10N6O3 — CID 51062678
[(Z)-2-(1-methyl-5-nitroimidazol-2-yl)ethylideneamino]urea (PubChem CID 51062678) has the molecular formula C7H10N6O3 and a molecular weight of 226.20 g/mol. Its IUPAC name is [(Z)-2-(1-methyl-5-nitroimidazol-2-yl)ethylideneamino]urea.
| Compound Name | [(Z)-2-(1-methyl-5-nitroimidazol-2-yl)ethylideneamino]urea |
|---|---|
| PubChem CID | 51062678 |
| Molecular Formula | C7H10N6O3 |
| Molecular Weight | 226.20 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | [(Z)-2-(1-methyl-5-nitroimidazol-2-yl)ethylideneamino]urea |
| SMILES | Cn1c([N+](=O)[O-])cnc1C/C=N\NC(N)=O |
| InChI | InChI=1S/C7H10N6O3/c1-12-5(2-3-10-11-7(8)14)9-4-6(12)13(15)16/h3-4H,2H2,1H3,(H3,8,11,14)/b10-3- |
| InChIKey | PBZUHYYGYBLPSJ-KMKOMSMNSA-N |
| XLogP | -0.48 |
| TPSA | 128.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.20 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|