C17H28N6O3 — CID 86803452
1-cyclohexyl-3-[1-[(1-methyl-5-nitroimidazol-2-yl)methyl]piperidin-4-yl]urea (PubChem CID 86803452) has the molecular formula C17H28N6O3 and a molecular weight of 364.45 g/mol. Its IUPAC name is 1-cyclohexyl-3-[1-[(1-methyl-5-nitroimidazol-2-yl)methyl]piperidin-4-yl]urea.
| Compound Name | 1-cyclohexyl-3-[1-[(1-methyl-5-nitroimidazol-2-yl)methyl]piperidin-4-yl]urea |
|---|---|
| PubChem CID | 86803452 |
| Molecular Formula | C17H28N6O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | 1-cyclohexyl-3-[1-[(1-methyl-5-nitroimidazol-2-yl)methyl]piperidin-4-yl]urea |
| SMILES | Cn1c([N+](=O)[O-])cnc1CN1CCC(NC(=O)NC2CCCCC2)CC1 |
| InChI | InChI=1S/C17H28N6O3/c1-21-15(18-11-16(21)23(25)26)12-22-9-7-14(8-10-22)20-17(24)19-13-5-3-2-4-6-13/h11,13-14H,2-10,12H2,1H3,(H2,19,20,24) |
| InChIKey | HCSSVBFTFXMYCI-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 105.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|