C15H19ClN6O3 — CID 174498384
1-chloro-5-methyl-N-[1-(1-methyl-5-nitroimidazol-2-yl)piperidin-4-yl]pyrrole-2-carboxamide (PubChem CID 174498384) has the molecular formula C15H19ClN6O3 and a molecular weight of 366.81 g/mol. Its IUPAC name is 1-chloro-5-methyl-N-[1-(1-methyl-5-nitroimidazol-2-yl)piperidin-4-yl]pyrrole-2-carboxamide.
| Compound Name | 1-chloro-5-methyl-N-[1-(1-methyl-5-nitroimidazol-2-yl)piperidin-4-yl]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 174498384 |
| Molecular Formula | C15H19ClN6O3 |
| Molecular Weight | 366.81 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 1-chloro-5-methyl-N-[1-(1-methyl-5-nitroimidazol-2-yl)piperidin-4-yl]pyrrole-2-carboxamide |
| SMILES | Cc1ccc(C(=O)NC2CCN(c3ncc([N+](=O)[O-])n3C)CC2)n1Cl |
| InChI | InChI=1S/C15H19ClN6O3/c1-10-3-4-12(21(10)16)14(23)18-11-5-7-20(8-6-11)15-17-9-13(19(15)2)22(24)25/h3-4,9,11H,5-8H2,1-2H3,(H,18,23) |
| InChIKey | HRINGFDYLFPMFH-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.81 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|