C11H12N6O4 — CID 168533159
[(1,3-dimethyl-6-nitro-2-oxobenzimidazol-5-yl)methylideneamino]urea (PubChem CID 168533159) has the molecular formula C11H12N6O4 and a molecular weight of 292.26 g/mol. Its IUPAC name is [(1,3-dimethyl-6-nitro-2-oxobenzimidazol-5-yl)methylideneamino]urea.
| Compound Name | [(1,3-dimethyl-6-nitro-2-oxobenzimidazol-5-yl)methylideneamino]urea |
|---|---|
| PubChem CID | 168533159 |
| Molecular Formula | C11H12N6O4 |
| Molecular Weight | 292.26 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | [(1,3-dimethyl-6-nitro-2-oxobenzimidazol-5-yl)methylideneamino]urea |
| SMILES | Cn1c(=O)n(C)c2cc([N+](=O)[O-])c(C=NNC(N)=O)cc21 |
| InChI | InChI=1S/C11H12N6O4/c1-15-8-3-6(5-13-14-10(12)18)7(17(20)21)4-9(8)16(2)11(15)19/h3-5H,1-2H3,(H3,12,14,18) |
| InChIKey | SBJQYNIYVNOMIK-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 137.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.26 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|