C8H7N5O5 — CID 168533904
[(3,4-dinitrophenyl)methylideneamino]urea (PubChem CID 168533904) has the molecular formula C8H7N5O5 and a molecular weight of 253.17 g/mol. Its IUPAC name is [(3,4-dinitrophenyl)methylideneamino]urea.
| Compound Name | [(3,4-dinitrophenyl)methylideneamino]urea |
|---|---|
| PubChem CID | 168533904 |
| Molecular Formula | C8H7N5O5 |
| Molecular Weight | 253.17 g/mol |
| Exact Mass | 253.04 |
| IUPAC Name | [(3,4-dinitrophenyl)methylideneamino]urea |
| SMILES | NC(=O)NN=Cc1ccc([N+](=O)[O-])c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C8H7N5O5/c9-8(14)11-10-4-5-1-2-6(12(15)16)7(3-5)13(17)18/h1-4H,(H3,9,11,14) |
| InChIKey | VOSCQYBCPBZCDR-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 153.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.17 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|