C9H6BrF3N4O4 — CID 168534047
[[3-bromo-5-nitro-4-(trifluoromethoxy)phenyl]methylideneamino]urea (PubChem CID 168534047) has the molecular formula C9H6BrF3N4O4 and a molecular weight of 371.07 g/mol. Its IUPAC name is [[3-bromo-5-nitro-4-(trifluoromethoxy)phenyl]methylideneamino]urea.
| Compound Name | [[3-bromo-5-nitro-4-(trifluoromethoxy)phenyl]methylideneamino]urea |
|---|---|
| PubChem CID | 168534047 |
| Molecular Formula | C9H6BrF3N4O4 |
| Molecular Weight | 371.07 g/mol |
| Exact Mass | 369.95 |
| IUPAC Name | [[3-bromo-5-nitro-4-(trifluoromethoxy)phenyl]methylideneamino]urea |
| SMILES | NC(=O)NN=Cc1cc(Br)c(OC(F)(F)F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C9H6BrF3N4O4/c10-5-1-4(3-15-16-8(14)18)2-6(17(19)20)7(5)21-9(11,12)13/h1-3H,(H3,14,16,18) |
| InChIKey | IHDLRTPNMOQIJU-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 119.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.07 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|