C6H8N4S2 — CID 119093932
[(E)-(4-methyl-1,3-thiazol-2-yl)methylideneamino]thiourea (PubChem CID 119093932) has the molecular formula C6H8N4S2 and a molecular weight of 200.29 g/mol. Its IUPAC name is [(E)-(4-methyl-1,3-thiazol-2-yl)methylideneamino]thiourea.
| Compound Name | [(E)-(4-methyl-1,3-thiazol-2-yl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 119093932 |
| Molecular Formula | C6H8N4S2 |
| Molecular Weight | 200.29 g/mol |
| Exact Mass | 200.02 |
| IUPAC Name | [(E)-(4-methyl-1,3-thiazol-2-yl)methylideneamino]thiourea |
| SMILES | Cc1csc(/C=N/NC(N)=S)n1 |
| InChI | InChI=1S/C6H8N4S2/c1-4-3-12-5(9-4)2-8-10-6(7)11/h2-3H,1H3,(H3,7,10,11)/b8-2+ |
| InChIKey | GYNUKLGFHARQAA-KRXBUXKQSA-N |
| XLogP | 0.62 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.29 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|