C8H6Cl2N4O2S — CID 168534273
[(3,5-dichloro-2-nitrophenyl)methylideneamino]thiourea (PubChem CID 168534273) has the molecular formula C8H6Cl2N4O2S and a molecular weight of 293.14 g/mol. Its IUPAC name is [(3,5-dichloro-2-nitrophenyl)methylideneamino]thiourea.
| Compound Name | [(3,5-dichloro-2-nitrophenyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 168534273 |
| Molecular Formula | C8H6Cl2N4O2S |
| Molecular Weight | 293.14 g/mol |
| Exact Mass | 291.96 |
| IUPAC Name | [(3,5-dichloro-2-nitrophenyl)methylideneamino]thiourea |
| SMILES | NC(=S)NN=Cc1cc(Cl)cc(Cl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C8H6Cl2N4O2S/c9-5-1-4(3-12-13-8(11)17)7(14(15)16)6(10)2-5/h1-3H,(H3,11,13,17) |
| InChIKey | PTPMUHNBCCKILT-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.14 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|