C11H7ClN4O4S — CID 6375789
[(E)-[amino-(5-nitro-1,3-thiazol-2-yl)methylidene]amino] 4-chlorobenzoate (PubChem CID 6375789) has the molecular formula C11H7ClN4O4S and a molecular weight of 326.72 g/mol. Its IUPAC name is [(E)-[amino-(5-nitro-1,3-thiazol-2-yl)methylidene]amino] 4-chlorobenzoate.
| Compound Name | [(E)-[amino-(5-nitro-1,3-thiazol-2-yl)methylidene]amino] 4-chlorobenzoate |
|---|---|
| PubChem CID | 6375789 |
| Molecular Formula | C11H7ClN4O4S |
| Molecular Weight | 326.72 g/mol |
| Exact Mass | 325.99 |
| IUPAC Name | [(E)-[amino-(5-nitro-1,3-thiazol-2-yl)methylidene]amino] 4-chlorobenzoate |
| SMILES | N/C(=N/OC(=O)c1ccc(Cl)cc1)c1ncc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C11H7ClN4O4S/c12-7-3-1-6(2-4-7)11(17)20-15-9(13)10-14-5-8(21-10)16(18)19/h1-5H,(H2,13,15) |
| InChIKey | DWTASHGCZIDBGZ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 120.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.72 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|