C20H32N2O2 — CID 154119324
[(8R,9S,10R,13S,14S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]urea (PubChem CID 154119324) has the molecular formula C20H32N2O2 and a molecular weight of 332.49 g/mol. Its IUPAC name is [(8R,9S,10R,13S,14S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]urea.
| Compound Name | [(8R,9S,10R,13S,14S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]urea |
|---|---|
| PubChem CID | 154119324 |
| Molecular Formula | C20H32N2O2 |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.25 |
| IUPAC Name | [(8R,9S,10R,13S,14S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]urea |
| SMILES | C[C@]12CCC(O)CC1=CC[C@@H]1[C@@H]2CC[C@]2(C)C(NC(N)=O)CC[C@@H]12 |
| InChI | InChI=1S/C20H32N2O2/c1-19-9-7-13(23)11-12(19)3-4-14-15-5-6-17(22-18(21)24)20(15,2)10-8-16(14)19/h3,13-17,23H,4-11H2,1-2H3,(H3,21,22,24)/t13?,14-,15-,16-,17?,19-,20-/m0/s1 |
| InChIKey | FKTHOXRGDBWDCL-RUQPPXTISA-N |
| XLogP | 3.35 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|