C20H34BNO2 — CID 59821427
N-[(3S,10R,13S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-methylboronamidic acid (PubChem CID 59821427) has the molecular formula C20H34BNO2 and a molecular weight of 331.31 g/mol. Its IUPAC name is N-[(3S,10R,13S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-methylboronamidic acid.
| Compound Name | N-[(3S,10R,13S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-methylboronamidic acid |
|---|---|
| PubChem CID | 59821427 |
| Molecular Formula | C20H34BNO2 |
| Molecular Weight | 331.31 g/mol |
| Exact Mass | 331.27 |
| IUPAC Name | N-[(3S,10R,13S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-methylboronamidic acid |
| SMILES | CB(O)NC1CCC2C3CC=C4C[C@@H](O)CC[C@]4(C)C3CC[C@]12C |
| InChI | InChI=1S/C20H34BNO2/c1-19-10-8-14(23)12-13(19)4-5-15-16-6-7-18(22-21(3)24)20(16,2)11-9-17(15)19/h4,14-18,22-24H,5-12H2,1-3H3/t14-,15?,16?,17?,18?,19-,20-/m0/s1 |
| InChIKey | LMCHSKNWNUEMPL-PFSDFEBHSA-N |
| XLogP | 3.38 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.31 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|