C24H26ClNO3 — CID 154121550
(5-benzyl-2-methylfuran-3-yl)methyl (2S)-2-(4-chloroanilino)-3-methylbutanoate (PubChem CID 154121550) has the molecular formula C24H26ClNO3 and a molecular weight of 411.93 g/mol. Its IUPAC name is (5-benzyl-2-methylfuran-3-yl)methyl (2S)-2-(4-chloroanilino)-3-methylbutanoate.
| Compound Name | (5-benzyl-2-methylfuran-3-yl)methyl (2S)-2-(4-chloroanilino)-3-methylbutanoate |
|---|---|
| PubChem CID | 154121550 |
| Molecular Formula | C24H26ClNO3 |
| Molecular Weight | 411.93 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | (5-benzyl-2-methylfuran-3-yl)methyl (2S)-2-(4-chloroanilino)-3-methylbutanoate |
| SMILES | Cc1oc(Cc2ccccc2)cc1COC(=O)[C@@H](Nc1ccc(Cl)cc1)C(C)C |
| InChI | InChI=1S/C24H26ClNO3/c1-16(2)23(26-21-11-9-20(25)10-12-21)24(27)28-15-19-14-22(29-17(19)3)13-18-7-5-4-6-8-18/h4-12,14,16,23,26H,13,15H2,1-3H3/t23-/m0/s1 |
| InChIKey | DLQGCESKNKOSQO-QHCPKHFHSA-N |
| XLogP | 6.01 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.93 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |