C16H34GeSi2 — CID 154126580
dimethyl-[2-(2-methylprop-1-enylsilyl)ethyl]-(2-triethylgermylethynyl)silane (PubChem CID 154126580) has the molecular formula C16H34GeSi2 and a molecular weight of 355.23 g/mol. Its IUPAC name is dimethyl-[2-(2-methylprop-1-enylsilyl)ethyl]-(2-triethylgermylethynyl)silane.
| Compound Name | dimethyl-[2-(2-methylprop-1-enylsilyl)ethyl]-(2-triethylgermylethynyl)silane |
|---|---|
| PubChem CID | 154126580 |
| Molecular Formula | C16H34GeSi2 |
| Molecular Weight | 355.23 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | dimethyl-[2-(2-methylprop-1-enylsilyl)ethyl]-(2-triethylgermylethynyl)silane |
| SMILES | CC[Ge](C#C[Si](C)(C)CC[SiH2]C=C(C)C)(CC)CC |
| InChI | InChI=1S/C16H34GeSi2/c1-8-17(9-2,10-3)11-13-19(6,7)14-12-18-15-16(4)5/h15H,8-10,12,14,18H2,1-7H3 |
| InChIKey | AORCITZRJLFAGV-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.23 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|