C11H25NSi — CID 154087974
N,N-diethyl-3-(2-methylprop-1-enylsilyl)propan-1-amine (PubChem CID 154087974) has the molecular formula C11H25NSi and a molecular weight of 199.41 g/mol. Its IUPAC name is N,N-diethyl-3-(2-methylprop-1-enylsilyl)propan-1-amine.
| Compound Name | N,N-diethyl-3-(2-methylprop-1-enylsilyl)propan-1-amine |
|---|---|
| PubChem CID | 154087974 |
| Molecular Formula | C11H25NSi |
| Molecular Weight | 199.41 g/mol |
| Exact Mass | 199.18 |
| IUPAC Name | N,N-diethyl-3-(2-methylprop-1-enylsilyl)propan-1-amine |
| SMILES | CCN(CC)CCC[SiH2]C=C(C)C |
| InChI | InChI=1S/C11H25NSi/c1-5-12(6-2)8-7-9-13-10-11(3)4/h10H,5-9,13H2,1-4H3 |
| InChIKey | SHTUYIQXGYBGGQ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.41 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|