C14H31NSi — CID 173072529
3-(3-methylbut-2-en-2-ylsilyl)-N,N-dipropylpropan-1-amine (PubChem CID 173072529) has the molecular formula C14H31NSi and a molecular weight of 241.49 g/mol. Its IUPAC name is 3-(3-methylbut-2-en-2-ylsilyl)-N,N-dipropylpropan-1-amine.
| Compound Name | 3-(3-methylbut-2-en-2-ylsilyl)-N,N-dipropylpropan-1-amine |
|---|---|
| PubChem CID | 173072529 |
| Molecular Formula | C14H31NSi |
| Molecular Weight | 241.49 g/mol |
| Exact Mass | 241.22 |
| IUPAC Name | 3-(3-methylbut-2-en-2-ylsilyl)-N,N-dipropylpropan-1-amine |
| SMILES | CCCN(CCC)CCC[SiH2]C(C)=C(C)C |
| InChI | InChI=1S/C14H31NSi/c1-6-9-15(10-7-2)11-8-12-16-14(5)13(3)4/h6-12,16H2,1-5H3 |
| InChIKey | RALFGWSVQPOOFU-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.49 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|