C16H38N2Si2 — CID 154039746
N,N,N',N'-tetraethyl-1-[3-(2-methylprop-1-enylsilyl)propylsilyl]methanediamine (PubChem CID 154039746) has the molecular formula C16H38N2Si2 and a molecular weight of 314.67 g/mol. Its IUPAC name is N,N,N',N'-tetraethyl-1-[3-(2-methylprop-1-enylsilyl)propylsilyl]methanediamine.
| Compound Name | N,N,N',N'-tetraethyl-1-[3-(2-methylprop-1-enylsilyl)propylsilyl]methanediamine |
|---|---|
| PubChem CID | 154039746 |
| Molecular Formula | C16H38N2Si2 |
| Molecular Weight | 314.67 g/mol |
| Exact Mass | 314.26 |
| IUPAC Name | N,N,N',N'-tetraethyl-1-[3-(2-methylprop-1-enylsilyl)propylsilyl]methanediamine |
| SMILES | CCN(CC)C([SiH2]CCC[SiH2]C=C(C)C)N(CC)CC |
| InChI | InChI=1S/C16H38N2Si2/c1-7-17(8-2)16(18(9-3)10-4)20-13-11-12-19-14-15(5)6/h14,16H,7-13,19-20H2,1-6H3 |
| InChIKey | PRPBCKXKEVPCGE-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.67 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|