C12H29NSi2 — CID 154127713
1-(2-methylprop-1-enylsilyl)-N-(triethylsilylmethyl)methanamine (PubChem CID 154127713) has the molecular formula C12H29NSi2 and a molecular weight of 243.54 g/mol. Its IUPAC name is 1-(2-methylprop-1-enylsilyl)-N-(triethylsilylmethyl)methanamine.
| Compound Name | 1-(2-methylprop-1-enylsilyl)-N-(triethylsilylmethyl)methanamine |
|---|---|
| PubChem CID | 154127713 |
| Molecular Formula | C12H29NSi2 |
| Molecular Weight | 243.54 g/mol |
| Exact Mass | 243.18 |
| IUPAC Name | 1-(2-methylprop-1-enylsilyl)-N-(triethylsilylmethyl)methanamine |
| SMILES | CC[Si](CC)(CC)CNC[SiH2]C=C(C)C |
| InChI | InChI=1S/C12H29NSi2/c1-6-15(7-2,8-3)11-13-10-14-9-12(4)5/h9,13H,6-8,10-11,14H2,1-5H3 |
| InChIKey | IZFVZIZZYSSEER-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.54 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|