C4H8N2O4 — CID 154128870
1,1-dihydroxy-3-(3-hydroxypropylidene)urea (PubChem CID 154128870) has the molecular formula C4H8N2O4 and a molecular weight of 148.12 g/mol. Its IUPAC name is 1,1-dihydroxy-3-(3-hydroxypropylidene)urea.
| Compound Name | 1,1-dihydroxy-3-(3-hydroxypropylidene)urea |
|---|---|
| PubChem CID | 154128870 |
| Molecular Formula | C4H8N2O4 |
| Molecular Weight | 148.12 g/mol |
| Exact Mass | 148.05 |
| IUPAC Name | 1,1-dihydroxy-3-(3-hydroxypropylidene)urea |
| SMILES | O=C(N=CCCO)N(O)O |
| InChI | InChI=1S/C4H8N2O4/c7-3-1-2-5-4(8)6(9)10/h2,7,9-10H,1,3H2 |
| InChIKey | PHVBQOJSOKHJDL-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 93.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.12 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|