C10H14O4 — CID 154129401
methyl 3-acetyloxyhepta-4,6-dienoate (PubChem CID 154129401) has the molecular formula C10H14O4 and a molecular weight of 198.22 g/mol. Its IUPAC name is methyl 3-acetyloxyhepta-4,6-dienoate.
| Compound Name | methyl 3-acetyloxyhepta-4,6-dienoate |
|---|---|
| PubChem CID | 154129401 |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | methyl 3-acetyloxyhepta-4,6-dienoate |
| SMILES | C=CC=CC(CC(=O)OC)OC(C)=O |
| InChI | InChI=1S/C10H14O4/c1-4-5-6-9(14-8(2)11)7-10(12)13-3/h4-6,9H,1,7H2,2-3H3 |
| InChIKey | DAKRLSXHCNQHCL-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|