About methyl 3-acetyloxyhepta-4,6-dienoate
methyl 3-acetyloxyhepta-4,6-dienoate (PubChem CID 154129401) has the molecular formula C10H14O4
and a molecular weight of 198.22 g/mol. Its IUPAC name is methyl 3-acetyloxyhepta-4,6-dienoate.
Molecular Properties
| Compound Name | methyl 3-acetyloxyhepta-4,6-dienoate |
| PubChem CID | 154129401 |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | methyl 3-acetyloxyhepta-4,6-dienoate |
| SMILES | C=CC=CC(CC(=O)OC)OC(C)=O |
| InChI | InChI=1S/C10H14O4/c1-4-5-6-9(14-8(2)11)7-10(12)13-3/h4-6,9H,1,7H2,2-3H3 |
| InChIKey | DAKRLSXHCNQHCL-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-acetyloxyhepta-4,6-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-acetyloxyhepta-4,6-dienoate?
The IUPAC name of methyl 3-acetyloxyhepta-4,6-dienoate (CID 154129401) is methyl 3-acetyloxyhepta-4,6-dienoate.
What is the SMILES notation for methyl 3-acetyloxyhepta-4,6-dienoate?
The canonical SMILES for methyl 3-acetyloxyhepta-4,6-dienoate is C=CC=CC(CC(=O)OC)OC(C)=O.
What is the InChIKey of methyl 3-acetyloxyhepta-4,6-dienoate?
The InChIKey is DAKRLSXHCNQHCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O4/c1-4-5-6-9(14-8(2)11)7-10(12)13-3/h4-6,9H,1,7H2,2-3H3.
What are the key properties of methyl 3-acetyloxyhepta-4,6-dienoate?
methyl 3-acetyloxyhepta-4,6-dienoate has a molecular weight of 198.22 g/mol, XLogP of 1.22, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-acetyloxyhepta-4,6-dienoate is sourced from PubChem (CID 154129401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).