About dichlororuthenium(2+);bis(1-methyl-3-propan-2-ylbenzene-4-ide)
dichlororuthenium(2+);bis(1-methyl-3-propan-2-ylbenzene-4-ide) (PubChem CID 154130262) has the molecular formula C20H26Cl2Ru
and a molecular weight of 438.40 g/mol. Its IUPAC name is dichlororuthenium(2+);bis(1-methyl-3-propan-2-ylbenzene-4-ide).
Molecular Properties
| Compound Name | dichlororuthenium(2+);bis(1-methyl-3-propan-2-ylbenzene-4-ide) |
| PubChem CID | 154130262 |
| Molecular Formula | C20H26Cl2Ru |
| Molecular Weight | 438.40 g/mol |
| Exact Mass | 438.05 |
| IUPAC Name | dichlororuthenium(2+);bis(1-methyl-3-propan-2-ylbenzene-4-ide) |
| SMILES | Cc1cc[c-]c(C(C)C)c1.Cc1cc[c-]c(C(C)C)c1.Cl[Ru+2]Cl |
| InChI | InChI=1S/2C10H13.2ClH.Ru/c2*1-8(2)10-6-4-5-9(3)7-10;;;/h2*4-5,7-8H,1-3H3;2*1H;/q2*-1;;;+4/p-2 |
| InChIKey | FYDKNLMKPCXUIJ-UHFFFAOYSA-L |
| XLogP | 7.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 438.40 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze dichlororuthenium(2+);bis(1-methyl-3-propan-2-ylbenzene-4-ide) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichlororuthenium(2+);bis(1-methyl-3-propan-2-ylbenzene-4-ide)?
The IUPAC name of dichlororuthenium(2+);bis(1-methyl-3-propan-2-ylbenzene-4-ide) (CID 154130262) is dichlororuthenium(2+);bis(1-methyl-3-propan-2-ylbenzene-4-ide).
What is the SMILES notation for dichlororuthenium(2+);bis(1-methyl-3-propan-2-ylbenzene-4-ide)?
The canonical SMILES for dichlororuthenium(2+);bis(1-methyl-3-propan-2-ylbenzene-4-ide) is Cc1cc[c-]c(C(C)C)c1.Cc1cc[c-]c(C(C)C)c1.Cl[Ru+2]Cl.
What is the InChIKey of dichlororuthenium(2+);bis(1-methyl-3-propan-2-ylbenzene-4-ide)?
The InChIKey is FYDKNLMKPCXUIJ-UHFFFAOYSA-L. The full InChI is InChI=1S/2C10H13.2ClH.Ru/c2*1-8(2)10-6-4-5-9(3)7-10;;;/h2*4-5,7-8H,1-3H3;2*1H;/q2*-1;;;+4/p-2.
What are the key properties of dichlororuthenium(2+);bis(1-methyl-3-propan-2-ylbenzene-4-ide)?
dichlororuthenium(2+);bis(1-methyl-3-propan-2-ylbenzene-4-ide) has a molecular weight of 438.40 g/mol, XLogP of 7.21, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dichlororuthenium(2+);bis(1-methyl-3-propan-2-ylbenzene-4-ide) is sourced from PubChem (CID 154130262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).