C9H9N3O3S — CID 154131692
2-amino-N-(1,3-oxazol-2-yl)benzenesulfonamide (PubChem CID 154131692) has the molecular formula C9H9N3O3S and a molecular weight of 239.26 g/mol. Its IUPAC name is 2-amino-N-(1,3-oxazol-2-yl)benzenesulfonamide.
| Compound Name | 2-amino-N-(1,3-oxazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 154131692 |
| Molecular Formula | C9H9N3O3S |
| Molecular Weight | 239.26 g/mol |
| Exact Mass | 239.04 |
| IUPAC Name | 2-amino-N-(1,3-oxazol-2-yl)benzenesulfonamide |
| SMILES | Nc1ccccc1S(=O)(=O)Nc1ncco1 |
| InChI | InChI=1S/C9H9N3O3S/c10-7-3-1-2-4-8(7)16(13,14)12-9-11-5-6-15-9/h1-6H,10H2,(H,11,12) |
| InChIKey | NJUJKTKHOALXGH-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.26 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|