C15H33N3O3 — CID 154133094
1,2,3-tris(2-methoxypropyl)triazinane (PubChem CID 154133094) has the molecular formula C15H33N3O3 and a molecular weight of 303.45 g/mol. Its IUPAC name is 1,2,3-tris(2-methoxypropyl)triazinane.
| Compound Name | 1,2,3-tris(2-methoxypropyl)triazinane |
|---|---|
| PubChem CID | 154133094 |
| Molecular Formula | C15H33N3O3 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.25 |
| IUPAC Name | 1,2,3-tris(2-methoxypropyl)triazinane |
| SMILES | COC(C)CN1CCCN(CC(C)OC)N1CC(C)OC |
| InChI | InChI=1S/C15H33N3O3/c1-13(19-4)10-16-8-7-9-17(11-14(2)20-5)18(16)12-15(3)21-6/h13-15H,7-12H2,1-6H3 |
| InChIKey | OOQFRSKWCDFECA-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 37.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |