C16H18O2 — CID 154135163
2-spiro[cyclohexane-1,1'-indene]-5'-ylacetic acid (PubChem CID 154135163) has the molecular formula C16H18O2 and a molecular weight of 242.32 g/mol. Its IUPAC name is 2-spiro[cyclohexane-1,1'-indene]-5'-ylacetic acid.
| Compound Name | 2-spiro[cyclohexane-1,1'-indene]-5'-ylacetic acid |
|---|---|
| PubChem CID | 154135163 |
| Molecular Formula | C16H18O2 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | 2-spiro[cyclohexane-1,1'-indene]-5'-ylacetic acid |
| SMILES | O=C(O)Cc1ccc2c(c1)C=CC21CCCCC1 |
| InChI | InChI=1S/C16H18O2/c17-15(18)11-12-4-5-14-13(10-12)6-9-16(14)7-2-1-3-8-16/h4-6,9-10H,1-3,7-8,11H2,(H,17,18) |
| InChIKey | HFZRHMCZYMOOBP-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |