C11H28N4Si — CID 154141406
N-[bis(methylamino)silyl]-N'-cyclopentyl-N'-ethylethane-1,2-diamine (PubChem CID 154141406) has the molecular formula C11H28N4Si and a molecular weight of 244.46 g/mol. Its IUPAC name is N-[bis(methylamino)silyl]-N'-cyclopentyl-N'-ethylethane-1,2-diamine.
| Compound Name | N-[bis(methylamino)silyl]-N'-cyclopentyl-N'-ethylethane-1,2-diamine |
|---|---|
| PubChem CID | 154141406 |
| Molecular Formula | C11H28N4Si |
| Molecular Weight | 244.46 g/mol |
| Exact Mass | 244.21 |
| IUPAC Name | N-[bis(methylamino)silyl]-N'-cyclopentyl-N'-ethylethane-1,2-diamine |
| SMILES | CCN(CCN[SiH](NC)NC)C1CCCC1 |
| InChI | InChI=1S/C11H28N4Si/c1-4-15(11-7-5-6-8-11)10-9-14-16(12-2)13-3/h11-14,16H,4-10H2,1-3H3 |
| InChIKey | SGQJNRHBGDFSKL-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 39.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.46 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|