About N-[bis(methylamino)silyl]-N'-cyclopentyl-N'-ethylethane-1,2-diamine
N-[bis(methylamino)silyl]-N'-cyclopentyl-N'-ethylethane-1,2-diamine (PubChem CID 154141406) has the molecular formula C11H28N4Si
and a molecular weight of 244.46 g/mol. Its IUPAC name is N-[bis(methylamino)silyl]-N'-cyclopentyl-N'-ethylethane-1,2-diamine.
Molecular Properties
| Compound Name | N-[bis(methylamino)silyl]-N'-cyclopentyl-N'-ethylethane-1,2-diamine |
| PubChem CID | 154141406 |
| Molecular Formula | C11H28N4Si |
| Molecular Weight | 244.46 g/mol |
| Exact Mass | 244.21 |
| IUPAC Name | N-[bis(methylamino)silyl]-N'-cyclopentyl-N'-ethylethane-1,2-diamine |
| SMILES | CCN(CCN[SiH](NC)NC)C1CCCC1 |
| InChI | InChI=1S/C11H28N4Si/c1-4-15(11-7-5-6-8-11)10-9-14-16(12-2)13-3/h11-14,16H,4-10H2,1-3H3 |
| InChIKey | SGQJNRHBGDFSKL-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 39.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.46 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N-[bis(methylamino)silyl]-N'-cyclopentyl-N'-ethylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[bis(methylamino)silyl]-N'-cyclopentyl-N'-ethylethane-1,2-diamine?
The IUPAC name of N-[bis(methylamino)silyl]-N'-cyclopentyl-N'-ethylethane-1,2-diamine (CID 154141406) is N-[bis(methylamino)silyl]-N'-cyclopentyl-N'-ethylethane-1,2-diamine.
What is the SMILES notation for N-[bis(methylamino)silyl]-N'-cyclopentyl-N'-ethylethane-1,2-diamine?
The canonical SMILES for N-[bis(methylamino)silyl]-N'-cyclopentyl-N'-ethylethane-1,2-diamine is CCN(CCN[SiH](NC)NC)C1CCCC1.
What is the InChIKey of N-[bis(methylamino)silyl]-N'-cyclopentyl-N'-ethylethane-1,2-diamine?
The InChIKey is SGQJNRHBGDFSKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H28N4Si/c1-4-15(11-7-5-6-8-11)10-9-14-16(12-2)13-3/h11-14,16H,4-10H2,1-3H3.
What are the key properties of N-[bis(methylamino)silyl]-N'-cyclopentyl-N'-ethylethane-1,2-diamine?
N-[bis(methylamino)silyl]-N'-cyclopentyl-N'-ethylethane-1,2-diamine has a molecular weight of 244.46 g/mol, XLogP of -0.00, 8 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[bis(methylamino)silyl]-N'-cyclopentyl-N'-ethylethane-1,2-diamine is sourced from PubChem (CID 154141406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).