C15H17ClO4 — CID 154143132
1-chloro-3-(6,7-dimethoxynaphthalen-1-yl)oxypropan-2-ol (PubChem CID 154143132) has the molecular formula C15H17ClO4 and a molecular weight of 296.75 g/mol. Its IUPAC name is 1-chloro-3-(6,7-dimethoxynaphthalen-1-yl)oxypropan-2-ol.
| Compound Name | 1-chloro-3-(6,7-dimethoxynaphthalen-1-yl)oxypropan-2-ol |
|---|---|
| PubChem CID | 154143132 |
| Molecular Formula | C15H17ClO4 |
| Molecular Weight | 296.75 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 1-chloro-3-(6,7-dimethoxynaphthalen-1-yl)oxypropan-2-ol |
| SMILES | COc1cc2cccc(OCC(O)CCl)c2cc1OC |
| InChI | InChI=1S/C15H17ClO4/c1-18-14-6-10-4-3-5-13(20-9-11(17)8-16)12(10)7-15(14)19-2/h3-7,11,17H,8-9H2,1-2H3 |
| InChIKey | JYJCMNGOURBDDH-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.75 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|