About 3aH-indeno[1,2-b]pyrrole-1-carboxylic acid
3aH-indeno[1,2-b]pyrrole-1-carboxylic acid (PubChem CID 154153484) has the molecular formula C12H9NO2
and a molecular weight of 199.21 g/mol. Its IUPAC name is 3aH-indeno[1,2-b]pyrrole-1-carboxylic acid.
Molecular Properties
| Compound Name | 3aH-indeno[1,2-b]pyrrole-1-carboxylic acid |
| PubChem CID | 154153484 |
| Molecular Formula | C12H9NO2 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | 3aH-indeno[1,2-b]pyrrole-1-carboxylic acid |
| SMILES | O=C(O)N1C=CC2C=c3ccccc3=C21 |
| InChI | InChI=1S/C12H9NO2/c14-12(15)13-6-5-9-7-8-3-1-2-4-10(8)11(9)13/h1-7,9H,(H,14,15) |
| InChIKey | RMGIHZOZBIUGMS-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3aH-indeno[1,2-b]pyrrole-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3aH-indeno[1,2-b]pyrrole-1-carboxylic acid?
The IUPAC name of 3aH-indeno[1,2-b]pyrrole-1-carboxylic acid (CID 154153484) is 3aH-indeno[1,2-b]pyrrole-1-carboxylic acid.
What is the SMILES notation for 3aH-indeno[1,2-b]pyrrole-1-carboxylic acid?
The canonical SMILES for 3aH-indeno[1,2-b]pyrrole-1-carboxylic acid is O=C(O)N1C=CC2C=c3ccccc3=C21.
What is the InChIKey of 3aH-indeno[1,2-b]pyrrole-1-carboxylic acid?
The InChIKey is RMGIHZOZBIUGMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9NO2/c14-12(15)13-6-5-9-7-8-3-1-2-4-10(8)11(9)13/h1-7,9H,(H,14,15).
What are the key properties of 3aH-indeno[1,2-b]pyrrole-1-carboxylic acid?
3aH-indeno[1,2-b]pyrrole-1-carboxylic acid has a molecular weight of 199.21 g/mol, XLogP of 0.71, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3aH-indeno[1,2-b]pyrrole-1-carboxylic acid is sourced from PubChem (CID 154153484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).