C13H17I2NO2 — CID 154154251
2-[(4-amino-3,5-diiodophenyl)methyl]hexanoic acid (PubChem CID 154154251) has the molecular formula C13H17I2NO2 and a molecular weight of 473.09 g/mol. Its IUPAC name is 2-[(4-amino-3,5-diiodophenyl)methyl]hexanoic acid.
| Compound Name | 2-[(4-amino-3,5-diiodophenyl)methyl]hexanoic acid |
|---|---|
| PubChem CID | 154154251 |
| Molecular Formula | C13H17I2NO2 |
| Molecular Weight | 473.09 g/mol |
| Exact Mass | 472.93 |
| IUPAC Name | 2-[(4-amino-3,5-diiodophenyl)methyl]hexanoic acid |
| SMILES | CCCCC(Cc1cc(I)c(N)c(I)c1)C(=O)O |
| InChI | InChI=1S/C13H17I2NO2/c1-2-3-4-9(13(17)18)5-8-6-10(14)12(16)11(15)7-8/h6-7,9H,2-5,16H2,1H3,(H,17,18) |
| InChIKey | IYFJIFWUNZTFEA-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.09 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|