C17H28N2O4 — CID 15415638
methyl (2E,6E)-6-[(2-methylpropan-2-yl)oxycarbonylhydrazinylidene]undeca-2,10-dienoate (PubChem CID 15415638) has the molecular formula C17H28N2O4 and a molecular weight of 324.42 g/mol. Its IUPAC name is methyl (2E,6E)-6-[(2-methylpropan-2-yl)oxycarbonylhydrazinylidene]undeca-2,10-dienoate.
| Compound Name | methyl (2E,6E)-6-[(2-methylpropan-2-yl)oxycarbonylhydrazinylidene]undeca-2,10-dienoate |
|---|---|
| PubChem CID | 15415638 |
| Molecular Formula | C17H28N2O4 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | methyl (2E,6E)-6-[(2-methylpropan-2-yl)oxycarbonylhydrazinylidene]undeca-2,10-dienoate |
| SMILES | C=CCCC/C(CC/C=C/C(=O)OC)=N\NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H28N2O4/c1-6-7-8-11-14(12-9-10-13-15(20)22-5)18-19-16(21)23-17(2,3)4/h6,10,13H,1,7-9,11-12H2,2-5H3,(H,19,21)/b13-10+,18-14+ |
| InChIKey | KKZHIWPGADUULB-BHTJOUODSA-N |
| XLogP | 3.73 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|