C22H43N2+ — CID 154158827
2,4,5-trihexyl-1-methyl-1H-imidazol-1-ium (PubChem CID 154158827) has the molecular formula C22H43N2+ and a molecular weight of 335.60 g/mol. Its IUPAC name is 2,4,5-trihexyl-1-methyl-1H-imidazol-1-ium.
| Compound Name | 2,4,5-trihexyl-1-methyl-1H-imidazol-1-ium |
|---|---|
| PubChem CID | 154158827 |
| Molecular Formula | C22H43N2+ |
| Molecular Weight | 335.60 g/mol |
| Exact Mass | 335.34 |
| IUPAC Name | 2,4,5-trihexyl-1-methyl-1H-imidazol-1-ium |
| SMILES | CCCCCCC1=NC(CCCCCC)=C(CCCCCC)[NH+]1C |
| InChI | InChI=1S/C22H42N2/c1-5-8-11-14-17-20-21(18-15-12-9-6-2)24(4)22(23-20)19-16-13-10-7-3/h5-19H2,1-4H3/p+1 |
| InChIKey | JYMARWIPTAZSTQ-UHFFFAOYSA-O |
| XLogP | 6.04 |
| TPSA | 16.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.60 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|