C11H12F3N3O3 — CID 154159367
2-[[6-(trifluoromethyl)pyrimidine-4-carbonyl]amino]pentanoic acid (PubChem CID 154159367) has the molecular formula C11H12F3N3O3 and a molecular weight of 291.23 g/mol. Its IUPAC name is 2-[[6-(trifluoromethyl)pyrimidine-4-carbonyl]amino]pentanoic acid.
| Compound Name | 2-[[6-(trifluoromethyl)pyrimidine-4-carbonyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 154159367 |
| Molecular Formula | C11H12F3N3O3 |
| Molecular Weight | 291.23 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 2-[[6-(trifluoromethyl)pyrimidine-4-carbonyl]amino]pentanoic acid |
| SMILES | CCCC(NC(=O)c1cc(C(F)(F)F)ncn1)C(=O)O |
| InChI | InChI=1S/C11H12F3N3O3/c1-2-3-6(10(19)20)17-9(18)7-4-8(11(12,13)14)16-5-15-7/h4-6H,2-3H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | OTILTVLANUFERD-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.23 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |