C13H15FN4O2 — CID 154160345
2-[1-(4-fluorophenyl)ethyl]-5-nitro-1H-pyridine-2,4-diamine (PubChem CID 154160345) has the molecular formula C13H15FN4O2 and a molecular weight of 278.29 g/mol. Its IUPAC name is 2-[1-(4-fluorophenyl)ethyl]-5-nitro-1H-pyridine-2,4-diamine.
| Compound Name | 2-[1-(4-fluorophenyl)ethyl]-5-nitro-1H-pyridine-2,4-diamine |
|---|---|
| PubChem CID | 154160345 |
| Molecular Formula | C13H15FN4O2 |
| Molecular Weight | 278.29 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 2-[1-(4-fluorophenyl)ethyl]-5-nitro-1H-pyridine-2,4-diamine |
| SMILES | CC(c1ccc(F)cc1)C1(N)C=C(N)C([N+](=O)[O-])=CN1 |
| InChI | InChI=1S/C13H15FN4O2/c1-8(9-2-4-10(14)5-3-9)13(16)6-11(15)12(7-17-13)18(19)20/h2-8,17H,15-16H2,1H3 |
| InChIKey | HQXYHYVAWXGHGD-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 107.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.29 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|