C8H14N4O2 — CID 162519842
5-nitro-2-propan-2-yl-1H-pyridine-2,3-diamine (PubChem CID 162519842) has the molecular formula C8H14N4O2 and a molecular weight of 198.23 g/mol. Its IUPAC name is 5-nitro-2-propan-2-yl-1H-pyridine-2,3-diamine.
| Compound Name | 5-nitro-2-propan-2-yl-1H-pyridine-2,3-diamine |
|---|---|
| PubChem CID | 162519842 |
| Molecular Formula | C8H14N4O2 |
| Molecular Weight | 198.23 g/mol |
| Exact Mass | 198.11 |
| IUPAC Name | 5-nitro-2-propan-2-yl-1H-pyridine-2,3-diamine |
| SMILES | CC(C)C1(N)NC=C([N+](=O)[O-])C=C1N |
| InChI | InChI=1S/C8H14N4O2/c1-5(2)8(10)7(9)3-6(4-11-8)12(13)14/h3-5,11H,9-10H2,1-2H3 |
| InChIKey | XTZNXBUICIRCMW-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 107.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.23 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|