About 4-thiocyanatobut-2-ynyl piperidine-1-carboxylate
4-thiocyanatobut-2-ynyl piperidine-1-carboxylate (PubChem CID 154167114) has the molecular formula C11H14N2O2S
and a molecular weight of 238.31 g/mol. Its IUPAC name is 4-thiocyanatobut-2-ynyl piperidine-1-carboxylate.
Molecular Properties
| Compound Name | 4-thiocyanatobut-2-ynyl piperidine-1-carboxylate |
| PubChem CID | 154167114 |
| Molecular Formula | C11H14N2O2S |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 4-thiocyanatobut-2-ynyl piperidine-1-carboxylate |
| SMILES | N#CSCC#CCOC(=O)N1CCCCC1 |
| InChI | InChI=1S/C11H14N2O2S/c12-10-16-9-5-4-8-15-11(14)13-6-2-1-3-7-13/h1-3,6-9H2 |
| InChIKey | PBHVWADLYPGDKM-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-thiocyanatobut-2-ynyl piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-thiocyanatobut-2-ynyl piperidine-1-carboxylate?
The IUPAC name of 4-thiocyanatobut-2-ynyl piperidine-1-carboxylate (CID 154167114) is 4-thiocyanatobut-2-ynyl piperidine-1-carboxylate.
What is the SMILES notation for 4-thiocyanatobut-2-ynyl piperidine-1-carboxylate?
The canonical SMILES for 4-thiocyanatobut-2-ynyl piperidine-1-carboxylate is N#CSCC#CCOC(=O)N1CCCCC1.
What is the InChIKey of 4-thiocyanatobut-2-ynyl piperidine-1-carboxylate?
The InChIKey is PBHVWADLYPGDKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O2S/c12-10-16-9-5-4-8-15-11(14)13-6-2-1-3-7-13/h1-3,6-9H2.
What are the key properties of 4-thiocyanatobut-2-ynyl piperidine-1-carboxylate?
4-thiocyanatobut-2-ynyl piperidine-1-carboxylate has a molecular weight of 238.31 g/mol, XLogP of 1.83, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-thiocyanatobut-2-ynyl piperidine-1-carboxylate is sourced from PubChem (CID 154167114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).