About cyclopentylcyclopentane
cyclopentylcyclopentane (PubChem CID 15417) has the molecular formula C10H18
and a molecular weight of 138.25 g/mol. Its IUPAC name is cyclopentylcyclopentane.
Molecular Properties
| Compound Name | cyclopentylcyclopentane |
| PubChem CID | 15417 |
| Molecular Formula | C10H18 |
| Molecular Weight | 138.25 g/mol |
| Exact Mass | 138.14 |
| IUPAC Name | cyclopentylcyclopentane |
| SMILES | C1CCC(C2CCCC2)C1 |
| InChI | InChI=1S/C10H18/c1-2-6-9(5-1)10-7-3-4-8-10/h9-10H,1-8H2 |
| InChIKey | MAWOHFOSAIXURX-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.25 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze cyclopentylcyclopentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentylcyclopentane?
The IUPAC name of cyclopentylcyclopentane (CID 15417) is cyclopentylcyclopentane.
What is the SMILES notation for cyclopentylcyclopentane?
The canonical SMILES for cyclopentylcyclopentane is C1CCC(C2CCCC2)C1.
What is the InChIKey of cyclopentylcyclopentane?
The InChIKey is MAWOHFOSAIXURX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18/c1-2-6-9(5-1)10-7-3-4-8-10/h9-10H,1-8H2.
What are the key properties of cyclopentylcyclopentane?
cyclopentylcyclopentane has a molecular weight of 138.25 g/mol, XLogP of 3.37, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentylcyclopentane is sourced from PubChem (CID 15417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).