C25H42O4Si — CID 154170132
10-(2-tert-butylsilyloxypropan-2-yl)-6-hydroxy-13-methyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-3,17-dione (PubChem CID 154170132) has the molecular formula C25H42O4Si and a molecular weight of 434.69 g/mol. Its IUPAC name is 10-(2-tert-butylsilyloxypropan-2-yl)-6-hydroxy-13-methyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | 10-(2-tert-butylsilyloxypropan-2-yl)-6-hydroxy-13-methyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 154170132 |
| Molecular Formula | C25H42O4Si |
| Molecular Weight | 434.69 g/mol |
| Exact Mass | 434.29 |
| IUPAC Name | 10-(2-tert-butylsilyloxypropan-2-yl)-6-hydroxy-13-methyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-3,17-dione |
| SMILES | CC(C)(C)[SiH2]OC(C)(C)C12CCC(=O)CC1C(O)CC1C3CCC(=O)C3(C)CCC12 |
| InChI | InChI=1S/C25H42O4Si/c1-22(2,3)30-29-23(4,5)25-12-9-15(26)13-19(25)20(27)14-16-17-7-8-21(28)24(17,6)11-10-18(16)25/h16-20,27H,7-14,30H2,1-6H3 |
| InChIKey | JKJNZNANLFEXHQ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.69 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|