C20H21N3O3 — CID 154174476
[3-(propanoylamino)phenyl] N-(1-cyano-2-phenylethyl)-N-methylcarbamate (PubChem CID 154174476) has the molecular formula C20H21N3O3 and a molecular weight of 351.41 g/mol. Its IUPAC name is [3-(propanoylamino)phenyl] N-(1-cyano-2-phenylethyl)-N-methylcarbamate.
| Compound Name | [3-(propanoylamino)phenyl] N-(1-cyano-2-phenylethyl)-N-methylcarbamate |
|---|---|
| PubChem CID | 154174476 |
| Molecular Formula | C20H21N3O3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | [3-(propanoylamino)phenyl] N-(1-cyano-2-phenylethyl)-N-methylcarbamate |
| SMILES | CCC(=O)Nc1cccc(OC(=O)N(C)C(C#N)Cc2ccccc2)c1 |
| InChI | InChI=1S/C20H21N3O3/c1-3-19(24)22-16-10-7-11-18(13-16)26-20(25)23(2)17(14-21)12-15-8-5-4-6-9-15/h4-11,13,17H,3,12H2,1-2H3,(H,22,24) |
| InChIKey | YYBRWPWPSLKFGX-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |