C14H20N2O2 — CID 154175506
4,5-dimethoxy-2-pyrrolidin-3-yl-1,3-dihydroisoindole (PubChem CID 154175506) has the molecular formula C14H20N2O2 and a molecular weight of 248.33 g/mol. Its IUPAC name is 4,5-dimethoxy-2-pyrrolidin-3-yl-1,3-dihydroisoindole.
| Compound Name | 4,5-dimethoxy-2-pyrrolidin-3-yl-1,3-dihydroisoindole |
|---|---|
| PubChem CID | 154175506 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | 4,5-dimethoxy-2-pyrrolidin-3-yl-1,3-dihydroisoindole |
| SMILES | COc1ccc2c(c1OC)CN(C1CCNC1)C2 |
| InChI | InChI=1S/C14H20N2O2/c1-17-13-4-3-10-8-16(11-5-6-15-7-11)9-12(10)14(13)18-2/h3-4,11,15H,5-9H2,1-2H3 |
| InChIKey | XHARQIFVCGCMPZ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |