C22H25NO4 — CID 155051488
(11S)-4,5,15-trimethoxy-1-azatetracyclo[9.8.0.03,8.012,17]nonadeca-3(8),4,6,12,14,16-hexaene-14-carbaldehyde (PubChem CID 155051488) has the molecular formula C22H25NO4 and a molecular weight of 367.45 g/mol. Its IUPAC name is (11S)-4,5,15-trimethoxy-1-azatetracyclo[9.8.0.03,8.012,17]nonadeca-3(8),4,6,12,14,16-hexaene-14-carbaldehyde.
| Compound Name | (11S)-4,5,15-trimethoxy-1-azatetracyclo[9.8.0.03,8.012,17]nonadeca-3(8),4,6,12,14,16-hexaene-14-carbaldehyde |
|---|---|
| PubChem CID | 155051488 |
| Molecular Formula | C22H25NO4 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | (11S)-4,5,15-trimethoxy-1-azatetracyclo[9.8.0.03,8.012,17]nonadeca-3(8),4,6,12,14,16-hexaene-14-carbaldehyde |
| SMILES | COc1cc2c(cc1C=O)[C@@H]1CCc3ccc(OC)c(OC)c3CN1CC2 |
| InChI | InChI=1S/C22H25NO4/c1-25-20-7-5-14-4-6-19-17-10-16(13-24)21(26-2)11-15(17)8-9-23(19)12-18(14)22(20)27-3/h5,7,10-11,13,19H,4,6,8-9,12H2,1-3H3/t19-/m0/s1 |
| InChIKey | RVHDDDVSEUPKTP-IBGZPJMESA-N |
| XLogP | 3.57 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|