C19H23NO2S — CID 130387400
(11S)-4,5-dimethoxy-14-methyl-15-thia-1-azatetracyclo[9.7.0.03,8.012,16]octadeca-3(8),4,6,12(16),13-pentaene (PubChem CID 130387400) has the molecular formula C19H23NO2S and a molecular weight of 329.47 g/mol. Its IUPAC name is (11S)-4,5-dimethoxy-14-methyl-15-thia-1-azatetracyclo[9.7.0.03,8.012,16]octadeca-3(8),4,6,12(16),13-pentaene.
| Compound Name | (11S)-4,5-dimethoxy-14-methyl-15-thia-1-azatetracyclo[9.7.0.03,8.012,16]octadeca-3(8),4,6,12(16),13-pentaene |
|---|---|
| PubChem CID | 130387400 |
| Molecular Formula | C19H23NO2S |
| Molecular Weight | 329.47 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | (11S)-4,5-dimethoxy-14-methyl-15-thia-1-azatetracyclo[9.7.0.03,8.012,16]octadeca-3(8),4,6,12(16),13-pentaene |
| SMILES | COc1ccc2c(c1OC)CN1CCc3sc(C)cc3[C@@H]1CC2 |
| InChI | InChI=1S/C19H23NO2S/c1-12-10-14-16-6-4-13-5-7-17(21-2)19(22-3)15(13)11-20(16)9-8-18(14)23-12/h5,7,10,16H,4,6,8-9,11H2,1-3H3/t16-/m0/s1 |
| InChIKey | QZOXUSYKRCYKDI-INIZCTEOSA-N |
| XLogP | 4.12 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.47 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |