C18H19NO3S — CID 130387349
(11S)-5-hydroxy-4-methoxy-14-methyl-15-thia-1-azatetracyclo[9.7.0.03,8.012,16]octadeca-3(8),4,6,12(16),13-pentaen-2-one (PubChem CID 130387349) has the molecular formula C18H19NO3S and a molecular weight of 329.42 g/mol. Its IUPAC name is (11S)-5-hydroxy-4-methoxy-14-methyl-15-thia-1-azatetracyclo[9.7.0.03,8.012,16]octadeca-3(8),4,6,12(16),13-pentaen-2-one.
| Compound Name | (11S)-5-hydroxy-4-methoxy-14-methyl-15-thia-1-azatetracyclo[9.7.0.03,8.012,16]octadeca-3(8),4,6,12(16),13-pentaen-2-one |
|---|---|
| PubChem CID | 130387349 |
| Molecular Formula | C18H19NO3S |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | (11S)-5-hydroxy-4-methoxy-14-methyl-15-thia-1-azatetracyclo[9.7.0.03,8.012,16]octadeca-3(8),4,6,12(16),13-pentaen-2-one |
| SMILES | COc1c(O)ccc2c1C(=O)N1CCc3sc(C)cc3[C@@H]1CC2 |
| InChI | InChI=1S/C18H19NO3S/c1-10-9-12-13-5-3-11-4-6-14(20)17(22-2)16(11)18(21)19(13)8-7-15(12)23-10/h4,6,9,13,20H,3,5,7-8H2,1-2H3/t13-/m0/s1 |
| InChIKey | CMKSZEYYWQDBPE-ZDUSSCGKSA-N |
| XLogP | 3.46 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |