About 2-N,3-dimethyl-1H-pyrrole-2,5-dicarboxamide
2-N,3-dimethyl-1H-pyrrole-2,5-dicarboxamide (PubChem CID 154175920) has the molecular formula C8H11N3O2
and a molecular weight of 181.19 g/mol. Its IUPAC name is 2-N,3-dimethyl-1H-pyrrole-2,5-dicarboxamide.
Molecular Properties
| Compound Name | 2-N,3-dimethyl-1H-pyrrole-2,5-dicarboxamide |
| PubChem CID | 154175920 |
| Molecular Formula | C8H11N3O2 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 2-N,3-dimethyl-1H-pyrrole-2,5-dicarboxamide |
| SMILES | CNC(=O)c1[nH]c(C(N)=O)cc1C |
| InChI | InChI=1S/C8H11N3O2/c1-4-3-5(7(9)12)11-6(4)8(13)10-2/h3,11H,1-2H3,(H2,9,12)(H,10,13) |
| InChIKey | QLTCTUXZHNKOMK-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 87.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-N,3-dimethyl-1H-pyrrole-2,5-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N,3-dimethyl-1H-pyrrole-2,5-dicarboxamide?
The IUPAC name of 2-N,3-dimethyl-1H-pyrrole-2,5-dicarboxamide (CID 154175920) is 2-N,3-dimethyl-1H-pyrrole-2,5-dicarboxamide.
What is the SMILES notation for 2-N,3-dimethyl-1H-pyrrole-2,5-dicarboxamide?
The canonical SMILES for 2-N,3-dimethyl-1H-pyrrole-2,5-dicarboxamide is CNC(=O)c1[nH]c(C(N)=O)cc1C.
What is the InChIKey of 2-N,3-dimethyl-1H-pyrrole-2,5-dicarboxamide?
The InChIKey is QLTCTUXZHNKOMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O2/c1-4-3-5(7(9)12)11-6(4)8(13)10-2/h3,11H,1-2H3,(H2,9,12)(H,10,13).
What are the key properties of 2-N,3-dimethyl-1H-pyrrole-2,5-dicarboxamide?
2-N,3-dimethyl-1H-pyrrole-2,5-dicarboxamide has a molecular weight of 181.19 g/mol, XLogP of -0.22, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N,3-dimethyl-1H-pyrrole-2,5-dicarboxamide is sourced from PubChem (CID 154175920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).