About 2-silylpentanoic acid
2-silylpentanoic acid (PubChem CID 154177343) has the molecular formula C5H12O2Si
and a molecular weight of 132.23 g/mol. Its IUPAC name is 2-silylpentanoic acid.
Molecular Properties
| Compound Name | 2-silylpentanoic acid |
| PubChem CID | 154177343 |
| Molecular Formula | C5H12O2Si |
| Molecular Weight | 132.23 g/mol |
| Exact Mass | 132.06 |
| IUPAC Name | 2-silylpentanoic acid |
| SMILES | CCCC([SiH3])C(=O)O |
| InChI | InChI=1S/C5H12O2Si/c1-2-3-4(8)5(6)7/h4H,2-3H2,1,8H3,(H,6,7) |
| InChIKey | XLLUGJCSRUOJHI-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.23 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-silylpentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-silylpentanoic acid?
The IUPAC name of 2-silylpentanoic acid (CID 154177343) is 2-silylpentanoic acid.
What is the SMILES notation for 2-silylpentanoic acid?
The canonical SMILES for 2-silylpentanoic acid is CCCC([SiH3])C(=O)O.
What is the InChIKey of 2-silylpentanoic acid?
The InChIKey is XLLUGJCSRUOJHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12O2Si/c1-2-3-4(8)5(6)7/h4H,2-3H2,1,8H3,(H,6,7).
What are the key properties of 2-silylpentanoic acid?
2-silylpentanoic acid has a molecular weight of 132.23 g/mol, XLogP of 0.03, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-silylpentanoic acid is sourced from PubChem (CID 154177343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).