C27H48O2Si — CID 154181559
1-[(8R,9S,10S,13S,14S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-triethylsilyloxyethanol (PubChem CID 154181559) has the molecular formula C27H48O2Si and a molecular weight of 432.77 g/mol. Its IUPAC name is 1-[(8R,9S,10S,13S,14S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-triethylsilyloxyethanol.
| Compound Name | 1-[(8R,9S,10S,13S,14S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-triethylsilyloxyethanol |
|---|---|
| PubChem CID | 154181559 |
| Molecular Formula | C27H48O2Si |
| Molecular Weight | 432.77 g/mol |
| Exact Mass | 432.34 |
| IUPAC Name | 1-[(8R,9S,10S,13S,14S)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-triethylsilyloxyethanol |
| SMILES | CC[Si](CC)(CC)OCC(O)C1=CC[C@H]2[C@@H]3CCC4CCCC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C27H48O2Si/c1-6-30(7-2,8-3)29-19-25(28)24-15-14-22-21-13-12-20-11-9-10-17-26(20,4)23(21)16-18-27(22,24)5/h15,20-23,25,28H,6-14,16-19H2,1-5H3/t20?,21-,22-,23-,25?,26-,27-/m0/s1 |
| InChIKey | MDDHDRIKKBQOAU-PWGKJNFUSA-N |
| XLogP | 7.34 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.77 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|