C20H18S3 — CID 15418230
3,5-bis[(4-methylphenyl)sulfanyl]benzenethiol (PubChem CID 15418230) has the molecular formula C20H18S3 and a molecular weight of 354.57 g/mol. Its IUPAC name is 3,5-bis[(4-methylphenyl)sulfanyl]benzenethiol.
| Compound Name | 3,5-bis[(4-methylphenyl)sulfanyl]benzenethiol |
|---|---|
| PubChem CID | 15418230 |
| Molecular Formula | C20H18S3 |
| Molecular Weight | 354.57 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | 3,5-bis[(4-methylphenyl)sulfanyl]benzenethiol |
| SMILES | Cc1ccc(Sc2cc(S)cc(Sc3ccc(C)cc3)c2)cc1 |
| InChI | InChI=1S/C20H18S3/c1-14-3-7-17(8-4-14)22-19-11-16(21)12-20(13-19)23-18-9-5-15(2)6-10-18/h3-13,21H,1-2H3 |
| InChIKey | MDDXBEGQFDEIDR-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.57 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|