C15H26N4 — CID 154184122
N,N-diethyl-2,2-dimethyl-3-(pyridin-4-ylmethylhydrazinylidene)propan-1-amine (PubChem CID 154184122) has the molecular formula C15H26N4 and a molecular weight of 262.40 g/mol. Its IUPAC name is N,N-diethyl-2,2-dimethyl-3-(pyridin-4-ylmethylhydrazinylidene)propan-1-amine.
| Compound Name | N,N-diethyl-2,2-dimethyl-3-(pyridin-4-ylmethylhydrazinylidene)propan-1-amine |
|---|---|
| PubChem CID | 154184122 |
| Molecular Formula | C15H26N4 |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.22 |
| IUPAC Name | N,N-diethyl-2,2-dimethyl-3-(pyridin-4-ylmethylhydrazinylidene)propan-1-amine |
| SMILES | CCN(CC)CC(C)(C)C=NNCc1ccncc1 |
| InChI | InChI=1S/C15H26N4/c1-5-19(6-2)13-15(3,4)12-18-17-11-14-7-9-16-10-8-14/h7-10,12,17H,5-6,11,13H2,1-4H3 |
| InChIKey | HTBIGKAOIYSQSW-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|