C12H22N4 — CID 154187063
4-cyclohexyl-5,6-dimethyl-1H-pyrimidine-2,4-diamine (PubChem CID 154187063) has the molecular formula C12H22N4 and a molecular weight of 222.34 g/mol. Its IUPAC name is 4-cyclohexyl-5,6-dimethyl-1H-pyrimidine-2,4-diamine.
| Compound Name | 4-cyclohexyl-5,6-dimethyl-1H-pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 154187063 |
| Molecular Formula | C12H22N4 |
| Molecular Weight | 222.34 g/mol |
| Exact Mass | 222.18 |
| IUPAC Name | 4-cyclohexyl-5,6-dimethyl-1H-pyrimidine-2,4-diamine |
| SMILES | CC1=C(C)C(N)(C2CCCCC2)N=C(N)N1 |
| InChI | InChI=1S/C12H22N4/c1-8-9(2)15-11(13)16-12(8,14)10-6-4-3-5-7-10/h10H,3-7,14H2,1-2H3,(H3,13,15,16) |
| InChIKey | SQARENNANDIAKI-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.34 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |