C18H13ClO4 — CID 154187172
2-[(10-chloroanthracen-9-yl)methyl]propanedioic acid (PubChem CID 154187172) has the molecular formula C18H13ClO4 and a molecular weight of 328.75 g/mol. Its IUPAC name is 2-[(10-chloroanthracen-9-yl)methyl]propanedioic acid.
| Compound Name | 2-[(10-chloroanthracen-9-yl)methyl]propanedioic acid |
|---|---|
| PubChem CID | 154187172 |
| Molecular Formula | C18H13ClO4 |
| Molecular Weight | 328.75 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | 2-[(10-chloroanthracen-9-yl)methyl]propanedioic acid |
| SMILES | O=C(O)C(Cc1c2ccccc2c(Cl)c2ccccc12)C(=O)O |
| InChI | InChI=1S/C18H13ClO4/c19-16-12-7-3-1-5-10(12)14(9-15(17(20)21)18(22)23)11-6-2-4-8-13(11)16/h1-8,15H,9H2,(H,20,21)(H,22,23) |
| InChIKey | KOKAYPCGJNSJQJ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.75 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|